| Name | tetracosanoic acid |
| Synonyms | L88 FL88 L88(fattyacid) Lignocerinsαure FL88(fattyacid) tetracosanoic acid Tetracosanoic acid (Lignoceric) |
| CAS | 557-59-5 |
| EINECS | 209-180-7 |
| InChI | InChI=1S/C24H48O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24(25)26/h2-23H2,1H3,(H,25,26) |
| Molecular Formula | C24H48O2 |
| Molar Mass | 368.64 |
| Density | 0.8790 |
| Melting Point | 80-82°C |
| Boling Point | 272°C10mm Hg(lit.) |
| Solubility | Chloroform (Slightly, Heated), Ethyl Acetate (Slightly) |
| Appearance | Shiny Crystalline Powder or Flakes |
| Color | White |
| Merck | 14,5488 |
| BRN | 1728237 |
| pKa | 4.78±0.10(Predicted) |
| Storage Condition | 2-8°C |
| Refractive Index | nD100 1.4287 |
| MDL | MFCD00002810 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | 26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| WGK Germany | - |
| HS Code | 29159000 |
| Reference Show more | 1. [IF=3] Qu Lala et al."Phenotypic assessment and ligand screening of ETA/ETB receptors with label-free dynamic mass redistribution assay."N-S Arch Pharmacol. 2020 Jun;393(6):937-950 |
| EPA chemical substance information | information provided by: ofmpeb.epa.gov (external link) |
| production method | 1. Tobacco: FC,42;FC,15; Obtained from birch tar, or by distillation of decayed quercitrin. |